ChemIndex - מאגר מידע CAS כימי חינמיToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
95727-77-8 2,6-Difluorobutyrophenone |
|
שם המוצר | 2,6-Difluorobutyrophenone |
נרדפות | 1-(2,6-difluorophenyl)butan-1-one; |
שם אנגלי | 2,6-Difluorobutyrophenone;1-(2,6-difluorophenyl)butan-1-one |
מולקולרית פורמולה | C10H10F2O |
משקל מולקולרי | 184.1826 |
InChl | InChI=1/C10H10F2O/c1-2-4-9(13)10-7(11)5-3-6-8(10)12/h3,5-6H,2,4H2,1H3 |
מספר CAS | 95727-77-8 |
מבנה מולקולרי | |
צפיפות | 1.134g/cm3 |
נקודת רתיחה | 219.6°C at 760 mmHg |
משקל סגולי | 1.472 |
נקודת הבזק | 82.6°C |
לחץ אדים | 0.118mmHg at 25°C |
סיכונים קודי | R36/38##Irritating to eyes and skin.:; |
בטיחות תיאור | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |