ChemIndex - מאגר מידע CAS כימי חינמיToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
94978-86-6 3-ציאנו-6,7-dimethylchromone |
|
שם המוצר | 3-ציאנו-6,7-dimethylchromone |
נרדפות | ; 6,7-דימתיל-4-אוקסו-4H-1-בנזופיראן-3-קרבוניטריל; 6,7-דימתיל-4-אוקסו-4H-כרום-3-קרבוניטריל; |
שם אנגלי | 3-cyano-6,7-dimethylchromone;6,7-Dimethyl-4-oxo-4H-1-benzopyran-3-carbonitrile;6,7-dimethyl-4-oxo-4H-chromene-3-carbonitrile |
מולקולרית פורמולה | C12H9NO2 |
משקל מולקולרי | 199.2054 |
InChl | InChI=1/C12H9NO2/c1-7-3-10-11(4-8(7)2)15-6-9(5-13)12(10)14/h3-4,6H,1-2H3 |
מספר CAS | 94978-86-6 |
מבנה מולקולרי | |
צפיפות | 1.25g/cm3 |
נקודת ההתוך | 206-209℃ |
נקודת רתיחה | 347.8°C at 760 mmHg |
משקל סגולי | 1.594 |
נקודת הבזק | 151.8°C |
לחץ אדים | 5.26E-05mmHg at 25°C |
Hazard סימנים | Xn##Harmful:; |
סיכונים קודי | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
בטיחות תיאור | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |