ChemIndex - מאגר מידע CAS כימי חינמיChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2-Ethyl-1,3-hexanediol, mixture of isomers |
|
שם המוצר | 2-Ethyl-1,3-hexanediol, mixture of isomers |
שם אנגלי | 2-Ethyl-1,3-hexanediol, mixture of isomers;Ethohexadiol;2-Ethylhexane-1,3-diol;octylene glycol;2-ethylhexane-1,1-diol;(2S,3S)-2-ethylhexane-1,3-diol;(2R,3S)-2-ethylhexane-1,3-diol;(2R,3R)-2-ethylhexane-1,3-diol;(2S,3R)-2-ethylhexane-1,3-diol;OG;2-Ethyl-1,3-Hexanediol |
מולקולרית פורמולה | C8H18O2 |
משקל מולקולרי | 146.2273 |
InChl | InChI=1/C8H18O2/c1-3-5-8(10)7(4-2)6-9/h7-10H,3-6H2,1-2H3/t7-,8+/m0/s1 |
מספר CAS | 94-96-2 |
EINECS | 202-377-9 |
מבנה מולקולרי | |
צפיפות | 0.935g/cm3 |
נקודת ההתוך | -40℃ |
נקודת רתיחה | 243°C at 760 mmHg |
משקל סגולי | 1.45 |
נקודת הבזק | 129.4°C |
מסיסות במים | 42 g/L (20℃) |
לחץ אדים | 0.00558mmHg at 25°C |
Hazard סימנים | Xi##Irritant:; |
סיכונים קודי | R41:; |
בטיחות תיאור | S25||S26||S39||S46:; |
MSDS |