ChemIndex - מאגר מידע CAS כימי חינמיChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
MCPB |
|
שם המוצר | MCPB |
שם אנגלי | MCPB;4-(4-Chloro-o-tolyloxy)butyric acid;2,4-MCPB;4-(4-Chloro-2-methylphenoxy)butyric acid;MCPB;4-(2-Methyl-4-chlorophenoxy)butyric acid;2-(4-chloro-2-methylphenoxy)butanoic acid |
מולקולרית פורמולה | C11H13ClO3 |
משקל מולקולרי | 228.6721 |
InChl | InChI=1/C11H13ClO3/c1-3-9(11(13)14)15-10-5-4-8(12)6-7(10)2/h4-6,9H,3H2,1-2H3,(H,13,14) |
מספר CAS | 94-81-5 |
EINECS | 202-365-3 |
מבנה מולקולרי | |
צפיפות | 1.228g/cm3 |
נקודת רתיחה | 345.1°C at 760 mmHg |
משקל סגולי | 1.536 |
נקודת הבזק | 162.5°C |
לחץ אדים | 2.39E-05mmHg at 25°C |
סיכונים קודי | R22##Harmful if swallowed.:; |
בטיחות תיאור | S24/25##Avoid contact with skin and eyes.:; |
MSDS |