Chemindex > 93-72-1
IL ▼
2-(2,4,5-Trichlorophenoxy)propionic acid |
|
| שם המוצר | 2-(2,4,5-Trichlorophenoxy)propionic acid |
| שם אנגלי | 2-(2,4,5-Trichlorophenoxy)propionic acid;Silvex;tube;Fenoprop~Silvex;(2R)-2-(2,4,5-trichlorophenoxy)propanoic acid;(2S)-2-(2,4,5-trichlorophenoxy)propanoate;(2R)-2-(2,4,5-trichlorophenoxy)propanoate |
| מולקולרית פורמולה | C9H6Cl3O3 |
| משקל מולקולרי | 268.5017 |
| InChl | InChI=1/C9H7Cl3O3/c1-4(9(13)14)15-8-3-6(11)5(10)2-7(8)12/h2-4H,1H3,(H,13,14)/p-1/t4-/m1/s1 |
| מספר CAS | 93-72-1 |
| EINECS | 202-271-2 |
| מבנה מולקולרי |  |
| נקודת ההתוך | 177-181℃ |
| נקודת רתיחה | 378.4°C at 760 mmHg |
| נקודת הבזק | 182.6°C |
| לחץ אדים | 2.13E-06mmHg at 25°C |
| Hazard סימנים |  Xn##Harmful||N##Dangerous for the environment:; |
| סיכונים קודי | R22##Harmful if swallowed.||R38##Irritating to skin.||R50/53##Very toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment.:; |
| בטיחות תיאור | S37##Wear suitable gloves.||S60##This material and its container must be disposed of as hazardous waste.||S61##Avoid release to the environment. Refer to special instructions / Safety data sheets.:; |
| MSDS | |
- אם אתם מתכננים מקור כימיקלים מסין, פשוט לכו לקניון ChemNet, נקבל את המחיר העדכני והתחרותי ביותר מיצרנים מסין עבורכם.אנא בקרו באתר
ChemNet Mall
שירות מסד הנתונים של CAS כימי מסופק ע& 