ChemIndex - מאגר מידע CAS כימי חינמיToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
927-67-3 n-Propylthiourea |
|
שם המוצר | n-Propylthiourea |
שם אנגלי | n-Propylthiourea;Propyl-2-thiourea;Propylthiourea;Thiourea, propyl-;1-propylthiourea |
מולקולרית פורמולה | C4H10N2S |
משקל מולקולרי | 118.2006 |
InChl | InChI=1/C4H10N2S/c1-2-3-6-4(5)7/h2-3H2,1H3,(H3,5,6,7) |
מספר CAS | 927-67-3 |
EINECS | 213-158-2 |
מבנה מולקולרי | ![]() |
צפיפות | 1.054g/cm3 |
נקודת רתיחה | 182.1°C at 760 mmHg |
משקל סגולי | 1.537 |
נקודת הבזק | 63.9°C |
לחץ אדים | 0.825mmHg at 25°C |
סיכונים קודי | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
בטיחות תיאור | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |