Chemindex > 85204-21-3
IL ▼
85204-21-3 4-[(2-ethylhexyl)amino]-4-oxoisocrotonic acid, תרכובת עם 2,2',2''-nitrilotris[אתנול] (1: 1) |
|
| שם המוצר | 4-[(2-ethylhexyl)amino]-4-oxoisocrotonic acid, תרכובת עם 2,2',2''-nitrilotris[אתנול] (1: 1) |
| נרדפות | 2-חומצה בוטנואית, 4-((2-אתילהקסיל)אמינו)-4-אוקסו-, (2Z)-, compd.עם 2,2',2''-nitrilotris (אתנול) (1: 1); 2-חומצה בוטנואית, 4-((2-אתילהקסיל)אמינו)-4-אוקסו-, (Z)-, compd.עם 2,2',2''-nitrilotris (אתנול) (1: 1); 4-((2-אתילהקסיל)אמינו)-4-חומצה אוקסואיזוקרוטונית, תרכובת עם 2,2',2''-ניטרילוטריס (אתנול) (1:1); (2Z)-4-[(2-ethylhexyl)amino]-4-oxobut-2-enoic acid - 2,2',2''-nitrilotriethanol (1:1); |
| שם אנגלי | 4-[(2-ethylhexyl)amino]-4-oxoisocrotonic acid, compound with 2,2',2''-nitrilotris[ethanol] (1:1);2-Butenoic acid, 4-((2-ethylhexyl)amino)-4-oxo-, (2Z)-, compd. with 2,2',2''-nitrilotris(ethanol) (1:1);2-Butenoic acid, 4-((2-ethylhexyl)amino)-4-oxo-, (Z)-, compd. with 2,2',2''-nitrilotris(ethanol) (1:1);4-((2-Ethylhexyl)amino)-4-oxoisocrotonic acid, compound with 2,2',2''-nitrilotris(ethanol) (1:1);(2Z)-4-[(2-ethylhexyl)amino]-4-oxobut-2-enoic acid - 2,2',2''-nitrilotriethanol (1:1) |
| מולקולרית פורמולה | C18H36N2O6 |
| משקל מולקולרי | 376.4882 |
| InChl | InChI=1/C12H21NO3.C6H15NO3/c1-3-5-6-10(4-2)9-13-11(14)7-8-12(15)16;8-4-1-7(2-5-9)3-6-10/h7-8,10H,3-6,9H2,1-2H3,(H,13,14)(H,15,16);8-10H,1-6H2/b8-7-; |
| מספר CAS | 85204-21-3 |
| EINECS | 286-316-1 |
| מבנה מולקולרי | ![85204-21-3 4-[(2-ethylhexyl)amino]-4-oxoisocrotonic acid, תרכובת עם 2,2',2''-nitrilotris[אתנול] (1: 1)](https://images-a.chemnet.com/suppliers/chembase/cas5/cas85204-21-3.gif "85204-21-3 4-[(2-ethylhexyl)amino]-4-oxoisocrotonic acid, תרכובת עם 2,2',2''-nitrilotris[אתנול] (1: 1)") |
| נקודת רתיחה | 411.8°C at 760 mmHg |
| נקודת הבזק | 202.8°C |
| לחץ אדים | 6.21E-08mmHg at 25°C |
| MSDS | |
- אם אתם מתכננים מקור כימיקלים מסין, פשוט לכו לקניון ChemNet, נקבל את המחיר העדכני והתחרותי ביותר מיצרנים מסין עבורכם.אנא בקרו באתר
ChemNet Mall
ספקים עבור 85204-21-3 (0):
שירות מסד הנתונים של CAS כימי מסופק ע& 