ChemIndex - מאגר מידע CAS כימי חינמיChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
5,6-Benzoquinoline |
|
שם המוצר | 5,6-Benzoquinoline |
שם אנגלי | 5,6-Benzoquinoline;beta-Naphthoquinoline;1-Azaphenanthrene;Benzo[f]quinoline;Benzoquinoline;benzo(f)quinoline |
מולקולרית פורמולה | C13H9N |
משקל מולקולרי | 179.2173 |
InChl | InChI=1/C13H9N/c1-2-5-11-10(4-1)7-8-13-12(11)6-3-9-14-13/h1-9H |
מספר CAS | 85-02-9 |
EINECS | 201-582-0 |
מבנה מולקולרי | |
צפיפות | 1.187g/cm3 |
נקודת ההתוך | 89-91℃ |
נקודת רתיחה | 350.4°C at 760 mmHg |
משקל סגולי | 1.726 |
נקודת הבזק | 155.9°C |
לחץ אדים | 8.89E-05mmHg at 25°C |
Hazard סימנים | Xn##Harmful:; |
סיכונים קודי | R36/37/38##Irritating to eyes, respiratory system and skin.||R40##Possible risks of irreversible effects.:; |
בטיחות תיאור | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |