ChemIndex - מאגר מידע CAS כימי חינמיChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
1-(chloromethyl)-2,4-dimethylbenzene |
|
שם המוצר | 1-(chloromethyl)-2,4-dimethylbenzene |
שם אנגלי | 1-(chloromethyl)-2,4-dimethylbenzene;2,4-Dimethylbenzyl chloride;4-(Chloromethyl)-m-xylene;2,4-Dimethylbenzylchloride |
מולקולרית פורמולה | C9H11Cl |
משקל מולקולרי | 154.6366 |
InChl | InChI=1/C9H11Cl/c1-7-3-4-9(6-10)8(2)5-7/h3-5H,6H2,1-2H3 |
מספר CAS | 824-55-5 |
EINECS | 212-531-7 |
מבנה מולקולרי | |
צפיפות | 1.033g/cm3 |
נקודת רתיחה | 215.5°C at 760 mmHg |
משקל סגולי | 1.522 |
נקודת הבזק | 86.5°C |
לחץ אדים | 0.216mmHg at 25°C |
Hazard סימנים | C##Corrosive:; |
סיכונים קודי | R34##Causes burns.||R36##Irritating to eyes.:; |
בטיחות תיאור | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |