ChemIndex - מאגר מידע CAS כימי חינמיToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
77-73-6 Dicyclopentadiene |
|
שם המוצר | Dicyclopentadiene |
שם אנגלי | Dicyclopentadiene;3a,4,7,7a-Tetrahydro-4,7-methanoindene;Cyclopentadiene dimer~3a,4,7,7a-Tetrahydro-4,7-methanoindene;DCPD;dicyclopentadiene (stabilized with bht);Dicyclopentadiene (>95%);Dicyclopentadiene (70%);Dicyopentadiene;Dicyclopentadiene (80%);Dicyclopentadiene dimer |
מולקולרית פורמולה | C10H12 |
משקל מולקולרי | 132.2 |
InChl | InChI=1/C10H12/c1-2-9-7-4-5-8(6-7)10(9)3-1/h1-2,4-5,7-10H,3,6H2 |
מספר CAS | 77-73-6 |
EINECS | 201-052-9 |
מבנה מולקולרי | |
צפיפות | 0.982 |
נקודת ההתוך | -1℃ |
נקודת רתיחה | 170℃ |
משקל סגולי | 1.51-1.512 |
נקודת הבזק | 26℃ |
Hazard סימנים | F##Flammable||Xn##Harmful||N##Dangerous for the environment:; |
סיכונים קודי | R11||R20/22||R36/37/38||R51/53:; |
בטיחות תיאור | S36/37||S61:; |
MSDS |