ChemIndex - מאגר מידע CAS כימי חינמיChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2,4-דימתיל-6-(1-מתילציקלוהקסיל)פנול |
|
שם המוצר | 2,4-דימתיל-6-(1-מתילציקלוהקסיל)פנול |
נרדפות | ; Lowinox(rg WSL; 6-(1-מתילציקלוהקסיל)-2,4-קסילנול; |
שם אנגלי | 2,4-Dimethyl-6-(1-methylcyclohexyl)phenol;Lowinox(rg WSL;6-(1-Methylcyclohexyl)-2,4-xylenol |
מולקולרית פורמולה | C15H22O |
משקל מולקולרי | 218.3346 |
InChl | InChI=1/C15H22O/c1-11-9-12(2)14(16)13(10-11)15(3)7-5-4-6-8-15/h9-10,16H,4-8H2,1-3H3 |
מספר CAS | 77-61-2 |
EINECS | 201-042-4 |
מבנה מולקולרי | |
צפיפות | 0.992g/cm3 |
נקודת רתיחה | 311°C at 760 mmHg |
משקל סגולי | 1.532 |
נקודת הבזק | 140°C |
לחץ אדים | 0.000317mmHg at 25°C |
סיכונים קודי | R36/37/38##Irritating to eyes, respiratory system and skin.||R43##May cause sensitization by skin contact.:; |
בטיחות תיאור | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |