ChemIndex - מאגר מידע CAS כימי חינמיToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
75-27-4 Bromodichloromethane |
|
שם המוצר | Bromodichloromethane |
שם אנגלי | Bromodichloromethane;FC-20B1 |
מולקולרית פורמולה | CHBrCl2 |
משקל מולקולרי | 163.8286 |
InChl | InChI=1/CHBrCl2/c2-1(3)4/h1H |
מספר CAS | 75-27-4 |
EINECS | 200-856-7 |
מבנה מולקולרי | ![]() |
צפיפות | 2.013g/cm3 |
נקודת ההתוך | -55℃ |
נקודת רתיחה | 89.7°C at 760 mmHg |
משקל סגולי | 1.503 |
נקודת הבזק | 1.3°C |
לחץ אדים | 65.3mmHg at 25°C |
Hazard סימנים | |
סיכונים קודי | R22##Harmful if swallowed.||R40##Possible risks of irreversible effects.:; |
בטיחות תיאור | S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |