ChemIndex - מאגר מידע CAS כימי חינמיToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
72856-73-6 2-methoxy-4-(methylthio)benzoic acid |
|
שם המוצר | 2-methoxy-4-(methylthio)benzoic acid |
שם אנגלי | 2-methoxy-4-(methylthio)benzoic acid;4-(Methylthio)-o-anisic acid;2-methoxy-4-(methylsulfanyl)benzoic acid |
מולקולרית פורמולה | C9H10O3S |
משקל מולקולרי | 198.2389 |
InChl | InChI=1/C9H10O3S/c1-12-8-5-6(13-2)3-4-7(8)9(10)11/h3-5H,1-2H3,(H,10,11) |
מספר CAS | 72856-73-6 |
EINECS | 276-948-6 |
מבנה מולקולרי | |
צפיפות | 1.29g/cm3 |
נקודת רתיחה | 342.3°C at 760 mmHg |
משקל סגולי | 1.592 |
נקודת הבזק | 160.8°C |
לחץ אדים | 2.92E-05mmHg at 25°C |
סיכונים קודי | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
בטיחות תיאור | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |