ChemIndex - מאגר מידע CAS כימי חינמיChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2,2-Bis(4-chlorophenyl)-1,1-dichloroethane |
|
שם המוצר | 2,2-Bis(4-chlorophenyl)-1,1-dichloroethane |
שם אנגלי | 2,2-Bis(4-chlorophenyl)-1,1-dichloroethane; |
מולקולרית פורמולה | C14H10Cl4 |
משקל מולקולרי | 320.04 |
InChl | InChI=1/C14H10Cl4/c15-11-5-1-9(2-6-11)13(14(17)18)10-3-7-12(16)8-4-10/h1-8,13-14H |
מספר CAS | 72-54-8 |
EINECS | 200-783-0 |
מבנה מולקולרי | |
נקודת ההתוך | 109-111℃ |
Hazard סימנים | T##Toxic:; |
סיכונים קודי | R23/24/25##Toxic by inhalation, in contact with skin and if swallowed.:; |
בטיחות תיאור | S23##Do not inhale gas/fumes/vapour/spray.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |