ChemIndex - מאגר מידע CAS כימי חינמיChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Pentafluorocinnamic acid |
|
שם המוצר | Pentafluorocinnamic acid |
שם אנגלי | Pentafluorocinnamic acid;2,3,4,5,6-Pentafluorocinnamic acid;(2E)-3-(pentafluorophenyl)prop-2-enoate;(2E)-3-(pentafluorophenyl)prop-2-enoic acid;3-(pentafluorophenyl)prop-2-enoate |
מולקולרית פורמולה | C9H2F5O2 |
משקל מולקולרי | 237.1035 |
InChl | InChI=1/C9H3F5O2/c10-5-3(1-2-4(15)16)6(11)8(13)9(14)7(5)12/h1-2H,(H,15,16)/p-1 |
מספר CAS | 719-60-8 |
מבנה מולקולרי | |
נקודת ההתוך | 152-156℃ |
נקודת רתיחה | 251.5°C at 760 mmHg |
נקודת הבזק | 105.9°C |
לחץ אדים | 0.0106mmHg at 25°C |
Hazard סימנים | Xi##Irritant:; |
סיכונים קודי | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
בטיחות תיאור | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |