ChemIndex - מאגר מידע CAS כימי חינמיChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2-chloro-4-fluoroacetophenone |
|
שם המוצר | 2-chloro-4-fluoroacetophenone |
שם אנגלי | 2-chloro-4-fluoroacetophenone;2'-chloro-4'-fluoroacetophenone;1-(2-chloro-4-fluoro-phenyl)ethanone |
מולקולרית פורמולה | C8H6ClFO |
משקל מולקולרי | 172.584 |
InChl | InChI=1/C8H6ClFO/c1-5(11)7-3-2-6(10)4-8(7)9/h2-4H,1H3 |
מספר CAS | 700-35-6 |
מבנה מולקולרי | |
צפיפות | 1.259g/cm3 |
נקודת רתיחה | 203.4°C at 760 mmHg |
משקל סגולי | 1.512 |
נקודת הבזק | 76.814°C |
לחץ אדים | 0.278mmHg at 25°C |
סיכונים קודי | R22##Harmful if swallowed.||R36/38##Irritating to eyes and skin.:; |
בטיחות תיאור | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |