ChemIndex - מאגר מידע CAS כימי חינמיToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
614-10-8 4-(2-Methylphenyl)-3-thiosemicarbazide |
|
שם המוצר | 4-(2-Methylphenyl)-3-thiosemicarbazide |
שם אנגלי | 4-(2-Methylphenyl)-3-thiosemicarbazide;4-(o-Tolyl)-3-thiosemicarbazide;N-(2-methylphenyl)hydrazinecarbothioamide;2-(2-methylphenyl)hydrazinecarbothioamide |
מולקולרית פורמולה | C8H11N3S |
משקל מולקולרי | 181.258 |
InChl | InChI=1/C8H11N3S/c1-6-4-2-3-5-7(6)10-11-8(9)12/h2-5,10H,1H3,(H3,9,11,12) |
מספר CAS | 614-10-8 |
מבנה מולקולרי | |
צפיפות | 1.27g/cm3 |
נקודת רתיחה | 295.9°C at 760 mmHg |
משקל סגולי | 1.699 |
נקודת הבזק | 132.8°C |
לחץ אדים | 0.00148mmHg at 25°C |
סיכונים קודי | R25##Toxic if swallowed.:; |
בטיחות תיאור | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |