ChemIndex - מאגר מידע CAS כימי חינמיToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
613-13-8 2-Aminoanthracene |
|
שם המוצר | 2-Aminoanthracene |
שם אנגלי | 2-Aminoanthracene;2-anthramine practical grade*crystalline;2-anthrylamine;2-Anthramine;2-Anthranamine;anthracen-2-amine;2-Anthracenamide; |
מולקולרית פורמולה | C14H11N |
משקל מולקולרי | 193.2438 |
InChl | InChI=1/C14H11N/c15-14-6-5-12-7-10-3-1-2-4-11(10)8-13(12)9-14/h1-9H,15H2 |
מספר CAS | 613-13-8 |
EINECS | 210-330-9 |
מבנה מולקולרי | ![]() |
צפיפות | 1.208g/cm3 |
נקודת ההתוך | 238-241℃ |
נקודת רתיחה | 414.2°C at 760 mmHg |
משקל סגולי | 1.765 |
נקודת הבזק | 229°C |
לחץ אדים | 4.52E-07mmHg at 25°C |
Hazard סימנים | |
סיכונים קודי | R33##Danger of cummulative effects.:; |
בטיחות תיאור | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |