ChemIndex - מאגר מידע CAS כימי חינמיToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
54-77-3 1,1-Dimethyl-4-phenylpiperazinium יודיד |
|
שם המוצר | 1,1-Dimethyl-4-phenylpiperazinium יודיד |
נרדפות | ; 1,1-dimethyl-4-phenylpiperazin-1-ium יודיד; |
שם אנגלי | 1,1-Dimethyl-4-phenylpiperazinium iodide;1,1-dimethyl-4-phenylpiperazin-1-ium iodide |
מולקולרית פורמולה | C12H19IN2 |
משקל מולקולרי | 318.1971 |
InChl | InChI=1/C12H19N2.HI/c1-14(2)10-8-13(9-11-14)12-6-4-3-5-7-12;/h3-7H,8-11H2,1-2H3;1H/q+1;/p-1 |
מספר CAS | 54-77-3 |
EINECS | 200-213-0 |
מבנה מולקולרי | |
נקודת ההתוך | 234-238℃ |
בטיחות תיאור | S24/25##Avoid contact with skin and eyes.:; |
MSDS |