Chemindex > 50529-33-4
IL ▼
50529-33-4 3-chloro-4-(fluorophenyl)isocyanate |
|
| שם המוצר | 3-chloro-4-(fluorophenyl)isocyanate |
| שם אנגלי | 3-chloro-4-(fluorophenyl)isocyanate;3-Chloro-4-fluorophenyl isocyanate;2-chloro-1-fluoro-4-isocyanatobenzene |
| מולקולרית פורמולה | C7H3ClFNO |
| משקל מולקולרי | 171.5562 |
| InChl | InChI=1/C7H3ClFNO/c8-6-3-5(10-4-11)1-2-7(6)9/h1-3H |
| מספר CAS | 50529-33-4 |
| מבנה מולקולרי |  |
| צפיפות | 1.31g/cm3 |
| נקודת רתיחה | 228.7°C at 760 mmHg |
| משקל סגולי | 1.533 |
| נקודת הבזק | 92.1°C |
| לחץ אדים | 0.0723mmHg at 25°C |
| Hazard סימנים |  Xn##Harmful:; |
| סיכונים קודי | R23/25##Toxic by inhalation and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.||R42##May cause sensitization by inhalation.:; |
| בטיחות תיאור | S23##Do not inhale gas/fumes/vapour/spray.||S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- אם אתם מתכננים מקור כימיקלים מסין, פשוט לכו לקניון ChemNet, נקבל את המחיר העדכני והתחרותי ביותר מיצרנים מסין עבורכם.אנא בקרו באתר
ChemNet Mall
שירות מסד הנתונים של CAS כימי מסופק ע& 