ChemIndex - מאגר מידע CAS כימי חינמיChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
1,4-ethylfluorobenzene |
|
שם המוצר | 1,4-ethylfluorobenzene |
שם אנגלי | 1,4-ethylfluorobenzene;1-Ethyl-4-fluorobenzene;benzene, 1-ethyl-4-fluoro-;Ethyl-4-fluorobenzene |
מולקולרית פורמולה | C8H9F |
משקל מולקולרי | 124.1555 |
InChl | InChI=1/C8H9F/c1-2-7-3-5-8(9)6-4-7/h3-6H,2H2,1H3 |
מספר CAS | 459-47-2 |
מבנה מולקולרי | |
צפיפות | 0.981g/cm3 |
נקודת רתיחה | 141.6°C at 760 mmHg |
משקל סגולי | 1.477 |
נקודת הבזק | 28.9°C |
לחץ אדים | 7.26mmHg at 25°C |
סיכונים קודי | R10##Flammable.:; |
בטיחות תיאור | S23##Do not inhale gas/fumes/vapour/spray.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |