ChemIndex - מאגר מידע CAS כימי חינמיToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
459-05-2 1-(4-fluorophenyl)-2-thiourea |
|
שם המוצר | 1-(4-fluorophenyl)-2-thiourea |
שם אנגלי | 1-(4-fluorophenyl)-2-thiourea;4-Fluorophenylthiourea;1-(4-fluorophenyl)thiourea |
מולקולרית פורמולה | C7H7FN2S |
משקל מולקולרי | 170.2073 |
InChl | InChI=1/C7H7FN2S/c8-5-1-3-6(4-2-5)10-7(9)11/h1-4H,(H3,9,10,11) |
מספר CAS | 459-05-2 |
מבנה מולקולרי | |
צפיפות | 1.397g/cm3 |
נקודת ההתוך | 164℃ |
נקודת רתיחה | 264.2°C at 760 mmHg |
משקל סגולי | 1.692 |
נקודת הבזק | 113.6°C |
לחץ אדים | 0.00987mmHg at 25°C |
סיכונים קודי | R25##Toxic if swallowed.:; |
בטיחות תיאור | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |