ChemIndex - מאגר מידע CAS כימי חינמיChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
1-Chloro-3-fluoro-2-propanol |
|
שם המוצר | 1-Chloro-3-fluoro-2-propanol |
שם אנגלי | 1-Chloro-3-fluoro-2-propanol;1-Chloro-3-fluoroisopropanol;1-chloro-3-fluoropropan-2-ol |
מולקולרית פורמולה | C3H6ClFO |
משקל מולקולרי | 112.5305 |
InChl | InChI=1/C3H6ClFO/c4-1-3(6)2-5/h3,6H,1-2H2 |
מספר CAS | 453-11-2 |
מבנה מולקולרי | |
צפיפות | 1.212g/cm3 |
נקודת רתיחה | 158.1°C at 760 mmHg |
משקל סגולי | 1.399 |
נקודת הבזק | 49.4°C |
לחץ אדים | 0.951mmHg at 25°C |
סיכונים קודי | R10##Flammable.||R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
בטיחות תיאור | S23##Do not inhale gas/fumes/vapour/spray.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |