ChemIndex - מאגר מידע CAS כימי חינמיChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Desyl chloride |
|
שם המוצר | Desyl chloride |
שם אנגלי | Desyl chloride;alpha-Chloro-alpha-phenylacetophenone;alpha-chlorodeoxybenzoin;2-chloro-1,2-diphenylethanone;(2R)-2-chloro-1,2-diphenylethanone;(2S)-2-chloro-1,2-diphenylethanone |
מולקולרית פורמולה | C14H11ClO |
משקל מולקולרי | 230.6895 |
InChl | InChI=1/C14H11ClO/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10,13H/t13-/m0/s1 |
מספר CAS | 447-31-4 |
EINECS | 207-181-7 |
מבנה מולקולרי | |
צפיפות | 1.19g/cm3 |
נקודת ההתוך | 65-69℃ |
נקודת רתיחה | 345.5°C at 760 mmHg |
משקל סגולי | 1.592 |
נקודת הבזק | 190.4°C |
לחץ אדים | 6.14E-05mmHg at 25°C |
Hazard סימנים | Xn##Harmful:; |
סיכונים קודי | R20/21##Harmful by inhalation and in contact with skin.||R37##Irritating to respiratory system.:; |
בטיחות תיאור | S22##Do not inhale dust.||S24##Avoid contact with skin.:; |
MSDS |