ChemIndex - מאגר מידע CAS כימי חינמיToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
446-09-3 2-Bromo-5-fluoronitrobenzene |
|
שם המוצר | 2-Bromo-5-fluoronitrobenzene |
שם אנגלי | 2-Bromo-5-fluoronitrobenzene;1-Bromo-4-fluoro-2-nitrobenzene |
מולקולרית פורמולה | C6H3BrFNO2 |
משקל מולקולרי | 219.9959 |
InChl | InChI=1/C6H3BrFNO2/c7-5-2-1-4(8)3-6(5)9(10)11/h1-3H |
מספר CAS | 446-09-3 |
EINECS | 207-160-2 |
מבנה מולקולרי | ![]() |
צפיפות | 1.808g/cm3 |
נקודת ההתוך | 37-39℃ |
נקודת רתיחה | 220.9°C at 760 mmHg |
משקל סגולי | 1.579 |
נקודת הבזק | 87.4°C |
לחץ אדים | 0.164mmHg at 25°C |
סיכונים קודי | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
בטיחות תיאור | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |