ChemIndex - מאגר מידע CAS כימי חינמיToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
42225-04-7 2-amino-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
|
שם המוצר | 2-amino-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
שם אנגלי | 2-amino-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile;(6S)-2-amino-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile;(6R)-2-amino-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
מולקולרית פורמולה | C10H12N2S |
משקל מולקולרי | 192.2807 |
InChl | InChI=1/C10H12N2S/c1-6-2-3-7-8(5-11)10(12)13-9(7)4-6/h6H,2-4,12H2,1H3/t6-/m1/s1 |
מספר CAS | 42225-04-7 |
מבנה מולקולרי | |
צפיפות | 1.22g/cm3 |
נקודת ההתוך | 147℃ |
נקודת רתיחה | 392.8°C at 760 mmHg |
משקל סגולי | 1.607 |
נקודת הבזק | 191.4°C |
לחץ אדים | 2.23E-06mmHg at 25°C |
Hazard סימנים | Xn##Harmful:; |
סיכונים קודי | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
בטיחות תיאור | S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |