Chemindex > 4004-95-9
IL ▼
4004-95-9 1-phenylpiperazine dihydrochloride |
|
| שם המוצר | 1-phenylpiperazine dihydrochloride |
| נרדפות | 1-פנילפיפרזין דיהידרוכלוריד; 1-פנילפיפרזין הידרוכלוריד |
| שם אנגלי | 1-phenylpiperazine dihydrochloride;1-Phenylpiperazine dihydrochloride;1-Phenylpiperazine HCl |
| מולקולרית פורמולה | C10H16Cl2N2 |
| משקל מולקולרי | 235.1534 |
| InChl | InChI=1/C10H14N2.2ClH/c1-2-4-10(5-3-1)12-8-6-11-7-9-12;;/h1-5,11H,6-9H2;2*1H |
| מספר CAS | 4004-95-9 |
| EINECS | 223-654-0 |
| מבנה מולקולרי |  |
| נקודת רתיחה | 287.2°C at 760 mmHg |
| נקודת הבזק | 138.3°C |
| לחץ אדים | 0.00252mmHg at 25°C |
| סיכונים קודי | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| בטיחות תיאור | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |
- אם אתם מתכננים מקור כימיקלים מסין, פשוט לכו לקניון ChemNet, נקבל את המחיר העדכני והתחרותי ביותר מיצרנים מסין עבורכם.אנא בקרו באתר
ChemNet Mall
שירות מסד הנתונים של CAS כימי מסופק ע& 