ChemIndex - מאגר מידע CAS כימי חינמיToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
347-55-7 2-(trifluoromethylthio)aniline |
|
שם המוצר | 2-(trifluoromethylthio)aniline |
שם אנגלי | 2-(trifluoromethylthio)aniline;2-Aminophenyl trifluoromethyl sulphide;4-(3-fluoro-4-methoxyphenyl)-4-oxobutanoic acid |
מולקולרית פורמולה | C11H11FO4 |
משקל מולקולרי | 226.201 |
InChl | InChI=1/C11H11FO4/c1-16-10-4-2-7(6-8(10)12)9(13)3-5-11(14)15/h2,4,6H,3,5H2,1H3,(H,14,15) |
מספר CAS | 347-55-7 |
EINECS | 206-473-1 |
מבנה מולקולרי | ![]() |
צפיפות | 1.279g/cm3 |
נקודת רתיחה | 422.6°C at 760 mmHg |
משקל סגולי | 1.52 |
נקודת הבזק | 209.4°C |
לחץ אדים | 6.78E-08mmHg at 25°C |
סיכונים קודי | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
בטיחות תיאור | S28##After contact with skin, wash immediately with plenty of ...||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |