Chemindex > 33904-03-9
IL ▼
33904-03-9 2,4-dimethoxyphenyl isothiocyanate |
|
| שם המוצר | 2,4-dimethoxyphenyl isothiocyanate |
| שם אנגלי | 2,4-dimethoxyphenyl isothiocyanate; |
| מולקולרית פורמולה | C9H9NO2S |
| משקל מולקולרי | 195.2383 |
| InChl | InChI=1/C9H9NO2S/c1-11-7-3-4-8(10-6-13)9(5-7)12-2/h3-5H,1-2H3 |
| מספר CAS | 33904-03-9 |
| מבנה מולקולרי |  |
| צפיפות | 1.12g/cm3 |
| נקודת ההתוך | 51℃ |
| נקודת רתיחה | 331°C at 760 mmHg |
| משקל סגולי | 1.537 |
| נקודת הבזק | 154°C |
| לחץ אדים | 0.000308mmHg at 25°C |
| Hazard סימנים |  Xn##Harmful:; |
| סיכונים קודי | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| בטיחות תיאור | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |
- אם אתם מתכננים מקור כימיקלים מסין, פשוט לכו לקניון ChemNet, נקבל את המחיר העדכני והתחרותי ביותר מיצרנים מסין עבורכם.אנא בקרו באתר
ChemNet Mall
ספקים עבור 33904-03-9 (0):
שירות מסד הנתונים של CAS כימי מסופק ע& 