ChemIndex - מאגר מידע CAS כימי חינמיToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
332-51-4 (4-fluorophenylthio)acetic acid |
|
שם המוצר | (4-fluorophenylthio)acetic acid |
שם אנגלי | (4-fluorophenylthio)acetic acid;2-[(4-Fluorophenyl)thio]acetic acid;[(4-fluorophenyl)sulfanyl]acetic acid;[(4-fluorophenyl)sulfanyl]acetate;2-(4-Fluorophenylthio)acetic acid |
מולקולרית פורמולה | C8H6FO2S |
משקל מולקולרי | 185.196 |
InChl | InChI=1/C8H7FO2S/c9-6-1-3-7(4-2-6)12-5-8(10)11/h1-4H,5H2,(H,10,11)/p-1 |
מספר CAS | 332-51-4 |
מבנה מולקולרי | ![]() |
נקודת ההתוך | 76-79℃ |
נקודת רתיחה | 315.4°C at 760 mmHg |
נקודת הבזק | 144.5°C |
לחץ אדים | 0.000185mmHg at 25°C |
Hazard סימנים | |
סיכונים קודי | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
בטיחות תיאור | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |