ChemIndex - מאגר מידע CAS כימי חינמיToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
332-43-4 1-(2-chloroethyl)-4-fluorobenzene |
|
שם המוצר | 1-(2-chloroethyl)-4-fluorobenzene |
שם אנגלי | 1-(2-chloroethyl)-4-fluorobenzene;4-Fluorophenethyl chloride~2-(4-Fluorophenyl)ethyl chloride |
מולקולרית פורמולה | C8H8ClF |
משקל מולקולרי | 158.6005 |
InChl | InChI=1/C8H8ClF/c9-6-5-7-1-3-8(10)4-2-7/h1-4H,5-6H2 |
מספר CAS | 332-43-4 |
EINECS | 206-364-9 |
מבנה מולקולרי | ![]() |
צפיפות | 1.15g/cm3 |
נקודת רתיחה | 204.6°C at 760 mmHg |
משקל סגולי | 1.501 |
נקודת הבזק | 79.9°C |
לחץ אדים | 0.373mmHg at 25°C |
סיכונים קודי | R36/38##Irritating to eyes and skin.:; |
בטיחות תיאור | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |