ChemIndex - מאגר מידע CAS כימי חינמיToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
331-62-4 3-fluoro-4-methoxybenzonitrile |
|
שם המוצר | 3-fluoro-4-methoxybenzonitrile |
שם אנגלי | 3-fluoro-4-methoxybenzonitrile;Fluoromethoxybenzonitrile |
מולקולרית פורמולה | C8H6FNO |
משקל מולקולרי | 151.1377 |
InChl | InChI=1/C8H6FNO/c1-11-8-3-2-6(5-10)4-7(8)9/h2-4H,1H3 |
מספר CAS | 331-62-4 |
מבנה מולקולרי | |
צפיפות | 1.18g/cm3 |
נקודת רתיחה | 254.3°C at 760 mmHg |
משקל סגולי | 1.505 |
נקודת הבזק | 107.6°C |
לחץ אדים | 0.0173mmHg at 25°C |
סיכונים קודי | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
בטיחות תיאור | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |