ChemIndex - מאגר מידע CAS כימי חינמיToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
330-94-9 4-(4-Fluorophenyl)-3-thiosemicarbazide |
|
שם המוצר | 4-(4-Fluorophenyl)-3-thiosemicarbazide |
שם אנגלי | 4-(4-Fluorophenyl)-3-thiosemicarbazide;N-(4-fluorophenyl)hydrazinecarbothioamide |
מולקולרית פורמולה | C7H8FN3S |
משקל מולקולרי | 185.2219 |
InChl | InChI=1/C7H8FN3S/c8-5-1-3-6(4-2-5)10-7(12)11-9/h1-4H,9H2,(H2,10,11,12) |
מספר CAS | 330-94-9 |
מבנה מולקולרי | |
צפיפות | 1.418g/cm3 |
נקודת רתיחה | 285°C at 760 mmHg |
משקל סגולי | 1.696 |
נקודת הבזק | 126.2°C |
לחץ אדים | 0.00287mmHg at 25°C |
סיכונים קודי | R25##Toxic if swallowed.:; |
בטיחות תיאור | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |