ChemIndex - מאגר מידע CAS כימי חינמיToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
312-21-0 4-(Trifluoromethylsulfonyl)benzonitrile |
|
שם המוצר | 4-(Trifluoromethylsulfonyl)benzonitrile |
שם אנגלי | 4-(Trifluoromethylsulfonyl)benzonitrile;4-Cyanophenyl trifluoromethyl sulphone;4-(Trifluoromethylsulphonyl)benzonitrile;4-(Trifluoromethanesulfonyl)benzonitrile |
מולקולרית פורמולה | C6H4FNO |
משקל מולקולרי | 125.1005 |
InChl | InChI=1/C6H4FNO/c7-5-2-1-3-8-6(5)4-9/h1-4H |
מספר CAS | 312-21-0 |
מבנה מולקולרי | |
צפיפות | 1.269g/cm3 |
נקודת ההתוך | 84-88℃ |
נקודת רתיחה | 166.5°C at 760 mmHg |
משקל סגולי | 1.543 |
נקודת הבזק | 54.5°C |
לחץ אדים | 1.78mmHg at 25°C |
סיכונים קודי | R22##Harmful if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
בטיחות תיאור | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |