ChemIndex - מאגר מידע CAS כימי חינמיToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
260-94-6 Acridine |
|
שם המוצר | Acridine |
שם אנגלי | Acridine;Dibenzo[b,e]pyridine |
מולקולרית פורמולה | C13H9N |
משקל מולקולרי | 179.2173 |
InChl | InChI=1/C13H9N/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12/h1-9H |
מספר CAS | 260-94-6 |
EINECS | 205-971-6 |
מבנה מולקולרי | |
צפיפות | 1.187g/cm3 |
נקודת ההתוך | 105-110℃ |
נקודת רתיחה | 346.7°C at 760 mmHg |
משקל סגולי | 1.726 |
נקודת הבזק | 153.8°C |
לחץ אדים | 0.000113mmHg at 25°C |
Hazard סימנים | Xn##Harmful:; |
סיכונים קודי | R22##Harmful if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
בטיחות תיאור | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |