ChemIndex - מאגר מידע CAS כימי חינמיToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
13679-73-7 2-Acetyl-4-methylthiophene |
|
שם המוצר | 2-Acetyl-4-methylthiophene |
שם אנגלי | 2-Acetyl-4-methylthiophene;1-(4-Methyl-2-thienyl)ethan-1-one;AI3-61742;Ethanone, 1-(4-methyl-2-thienyl)-;1-(4-methylthiophen-2-yl)ethanone |
מולקולרית פורמולה | C7H8OS |
משקל מולקולרי | 140.2028 |
InChl | InChI=1/C7H8OS/c1-5-3-7(6(2)8)9-4-5/h3-4H,1-2H3 |
מספר CAS | 13679-73-7 |
EINECS | 237-180-7 |
מבנה מולקולרי | |
צפיפות | 1.106g/cm3 |
נקודת רתיחה | 236.9°C at 760 mmHg |
משקל סגולי | 1.535 |
נקודת הבזק | 97.1°C |
לחץ אדים | 0.0461mmHg at 25°C |
סיכונים קודי | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
בטיחות תיאור | S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |