ChemIndex - מאגר מידע CAS כימי חינמיToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
13090-86-3 חומצה בנזואית, תרכובת עם 2,2',2''-nitrilotriethanol (1: 1) |
|
שם המוצר | חומצה בנזואית, תרכובת עם 2,2',2''-nitrilotriethanol (1: 1) |
נרדפות | חומצה בנזואית, תרכובת עם 2,2',2''-nitrilotriethanol (1: 1); חומצה בנזואית, compd.עם 2,2',2''-nitrilotris (אתנול) (1: 1); 2-hydroxy-N,N-bis(2-hydroxyethyl)ethanaminium benzoate; |
שם אנגלי | benzoic acid, compound with 2,2',2''-nitrilotriethanol (1:1);Benzoic acid, compound with 2,2',2''-nitrilotriethanol (1:1);Benzoic acid, compd. with 2,2',2''-nitrilotris(ethanol) (1:1);2-hydroxy-N,N-bis(2-hydroxyethyl)ethanaminium benzoate |
מולקולרית פורמולה | C13H21NO5 |
משקל מולקולרי | 271.3095 |
InChl | InChI=1/C7H6O2.C6H15NO3/c8-7(9)6-4-2-1-3-5-6;8-4-1-7(2-5-9)3-6-10/h1-5H,(H,8,9);8-10H,1-6H2 |
מספר CAS | 13090-86-3 |
EINECS | 236-002-5 |
מבנה מולקולרי | |
נקודת רתיחה | 518.5°C at 760 mmHg |
נקודת הבזק | 267.4°C |
לחץ אדים | 1.41E-11mmHg at 25°C |
MSDS |