ChemIndex - מאגר מידע CAS כימי חינמיToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
1206-15-1 1-(4-Methoxyphenyl)-1-cyclopentanecarbonitrile |
|
שם המוצר | 1-(4-Methoxyphenyl)-1-cyclopentanecarbonitrile |
נרדפות | 1-(4-מתוקסיפניל)ציקלופנטאןקרבוניטריל |
שם אנגלי | 1-(4-Methoxyphenyl)-1-cyclopentanecarbonitrile;1-(4-Methoxyphenyl)cyclopentanecarbonitrile |
מולקולרית פורמולה | C13H15NO |
משקל מולקולרי | 201.2643 |
InChl | InChI=1/C13H15NO/c1-15-12-6-4-11(5-7-12)13(10-14)8-2-3-9-13/h4-7H,2-3,8-9H2,1H3 |
מספר CAS | 1206-15-1 |
EINECS | 214-890-5 |
מבנה מולקולרי | |
צפיפות | 1.07g/cm3 |
נקודת רתיחה | 346.4°C at 760 mmHg |
משקל סגולי | 1.543 |
נקודת הבזק | 146.2°C |
לחץ אדים | 5.76E-05mmHg at 25°C |
Hazard סימנים | Xn##Harmful:; |
סיכונים קודי | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
בטיחות תיאור | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |