114-33-0 N-Methylnicotinamide |
שם המוצר |
N-Methylnicotinamide |
שם אנגלי |
N-Methylnicotinamide;Methylnicotinamide;N-methylpyridine-3-carboxamide |
מולקולרית פורמולה |
C7H8N2O |
משקל מולקולרי |
136.1512 |
InChl |
InChI=1/C7H8N2O/c1-8-7(10)6-3-2-4-9-5-6/h2-5H,1H3,(H,8,10) |
מספר CAS |
114-33-0 |
EINECS |
204-046-4 |
מבנה מולקולרי |
|
צפיפות |
1.106g/cm3 |
נקודת ההתוך |
100-105℃ |
נקודת רתיחה |
347.7°C at 760 mmHg |
משקל סגולי |
1.529 |
נקודת הבזק |
164.1°C |
לחץ אדים |
5.3E-05mmHg at 25°C |
Hazard סימנים |
Xi##Irritant:;
|
סיכונים קודי |
R36/37/38##Irritating to eyes, respiratory system and skin.:;
|
בטיחות תיאור |
S24/25##Avoid contact with skin and eyes.:;
|
MSDS |
Material Safety Data Sheet |