112-61-8 Methyl stearate |
שם המוצר |
Methyl stearate |
שם אנגלי |
Methyl stearate;Methyl n-octadecanoate;Stearic acid methyl ester;methyl octadecanoate;Me-ST |
מולקולרית פורמולה |
C19H38O2 |
משקל מולקולרי |
298.5038 |
InChl |
InChI=1/C19H38O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21-2/h3-18H2,1-2H3 |
מספר CAS |
112-61-8 |
EINECS |
203-990-4 |
מבנה מולקולרי |
|
צפיפות |
0.863g/cm3 |
נקודת ההתוך |
37-39℃ |
נקודת רתיחה |
355.5°C at 760 mmHg |
משקל סגולי |
1.444 |
נקודת הבזק |
169.3°C |
לחץ אדים |
3.11E-05mmHg at 25°C |
בטיחות תיאור |
S24/25##Avoid contact with skin and eyes.:;
|
MSDS |
Material Safety Data Sheet |