ChemIndex - מאגר מידע CAS כימי חינמיToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
111-12-6 Methyl 2-octynoate |
|
שם המוצר | Methyl 2-octynoate |
שם אנגלי | Methyl 2-octynoate;Methyl heptine carbonate;2-Octynoic acid, methyl ester;FEMA No. 2729;Folione;Methyl 2-octinate;Methyl 2-octynate;Methyl hept-1-yne-1-carboxylate;Methyl pentylacetylenecarboxylate;Vert de violette, artificial;Methyl oct-2-ynoate |
מולקולרית פורמולה | C9H14O2 |
משקל מולקולרי | 154.2063 |
InChl | InChI=1/C9H14O2/c1-3-4-5-6-7-8-9(10)11-2/h3-6H2,1-2H3 |
מספר CAS | 111-12-6;53073-28-2 |
EINECS | 203-836-6 |
מבנה מולקולרי | |
צפיפות | 0.94g/cm3 |
נקודת רתיחה | 218.5°C at 760 mmHg |
משקל סגולי | 1.443 |
נקודת הבזק | 88.9°C |
לחץ אדים | 0.125mmHg at 25°C |
סיכונים קודי | R22##Harmful if swallowed.||R36/38##Irritating to eyes and skin.:; |
בטיחות תיאור | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |