ChemIndex - מאגר מידע CAS כימי חינמיChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
1,4-Cyclohexanedimethanol, mixture of cisand trans |
|
שם המוצר | 1,4-Cyclohexanedimethanol, mixture of cisand trans |
שם אנגלי | 1,4-Cyclohexanedimethanol, mixture of cisand trans;1,4-Bis(hydroxymethyl)cyclohexane;cyclohex-1,4-ylenedimethanol;1,4-Cyclohexane dimethanol;cyclohexane-1,4-diyldimethanol;1,4-Cyclohexanedimethanol;CHDM |
מולקולרית פורמולה | C8H16O2 |
משקל מולקולרי | 144.2114 |
InChl | InChI=1/C8H16O2/c9-5-7-1-2-8(6-10)4-3-7/h7-10H,1-6H2 |
מספר CAS | 105-08-8 |
EINECS | 203-268-9 |
מבנה מולקולרי | |
צפיפות | 1.004g/cm3 |
נקודת ההתוך | 31.5℃ |
נקודת רתיחה | 286.2°C at 760 mmHg |
משקל סגולי | 1.47 |
נקודת הבזק | 161.1°C |
מסיסות במים | miscible |
לחץ אדים | 0.000303mmHg at 25°C |
סיכונים קודי | R36:; |
בטיחות תיאור | S26||S39:; |
MSDS |