ChemIndex - מאגר מידע CAS כימי חינמיChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
N-Phenylurethane |
|
שם המוצר | N-Phenylurethane |
שם אנגלי | N-Phenylurethane;Ethyl carbanilate~Ethyl N-phenylcarbamate;ethyl phenylcarbamate |
מולקולרית פורמולה | C9H11NO2 |
משקל מולקולרי | 165.1891 |
InChl | InChI=1/C9H11NO2/c1-2-12-9(11)10-8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H,10,11) |
מספר CAS | 101-99-5 |
EINECS | 202-995-9 |
מבנה מולקולרי | |
צפיפות | 1.136g/cm3 |
נקודת רתיחה | 238°C at 760 mmHg |
משקל סגולי | 1.558 |
נקודת הבזק | 79.2°C |
לחץ אדים | 0.0434mmHg at 25°C |
סיכונים קודי | R40##Possible risks of irreversible effects.:; |
בטיחות תיאור | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |