ChemIndex - מאגר מידע CAS כימי חינמיChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
m-Vinyltoluene |
|
שם המוצר | m-Vinyltoluene |
שם אנגלי | m-Vinyltoluene;3-Methylstyrene;3-Vinyltoluene |
מולקולרית פורמולה | C9H10 |
משקל מולקולרי | 118.17 |
InChl | InChI=1/C9H10/c1-3-9-6-4-5-8(2)7-9/h3-7H,1H2,2H3 |
מספר CAS | 100-80-1 |
EINECS | 202-889-2 |
מבנה מולקולרי | |
צפיפות | 170 |
נקודת רתיחה | 171℃ |
סיכונים קודי | R10##Flammable.||R20##Harmful by inhalation.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
בטיחות תיאור | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |