Chemindex > 99-48-9
ID ▼
99-48-9 (-)-Carveol |
|
| Nama produk | (-)-Carveol |
| Nama bahasa Inggris | (-)-Carveol;p-Mentha-6,8-dien-2-ol;Carveol;1-Methyl-4-isopropenyl-6-cyclohexen-2-ol;2-06-00-00102 (Beilstein Handbook Reference);2-Cyclohexen-1-ol, 2-methyl-5-(1-methylethenyl)-;2-Methyl-5-(1-methylethenyl)-2-cyclohexen-1-ol;2-Methyl-5-isopropenyl-2-cyclohexen-1-ol;5-Isopropenyl-2-methyl-2-cyclohexen-1-ol;AI3-27596;BRN 1861032;CCRIS 6219;EINECS 202-757-4;FEMA No. 2247;NSC 68313;UNII-1L9KXT85R9;p-Mentha-1,8-dien-6-ol;p-Mentha-1(6),8-dien-2-ol;2-methyl-5-(prop-1-en-2-yl)cyclohex-2-en-1-ol;(1S,5S)-2-methyl-5-(prop-1-en-2-yl)cyclohex-2-en-1-ol;(1R,5S)-2-methyl-5-(prop-1-en-2-yl)cyclohex-2-en-1-ol;(5R)-2-methyl-5-(1-methylethenyl)cyclohex-2-en-1-ol |
| MF | C10H16O |
| Berat Molekul | 152.2334 |
| InChI | InChI=1/C10H16O/c1-7(2)9-5-4-8(3)10(11)6-9/h4,9-11H,1,5-6H2,2-3H3/t9-,10?/m1/s1 |
| CAS NO | 99-48-9;20307-86-2;22567-18-6 |
| EINECS | 202-757-4 |
| Struktur Molekul |  |
| Kepadatan | 0.949g/cm3 |
| Titik didih | 231.5°C at 760 mmHg |
| Indeks bias | 1.497 |
| Titik nyala | 91.2°C |
| Tekanan uap | 0.0117mmHg at 25°C |
| Keselamatan Deskripsi | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |
- Jika Anda berencana untuk mendapatkan bahan kimia dari China, pergi saja ke mal ChemNet, kami akan mendapatkan harga terbaru dan kompetitif dari produsen China untuk Anda.Silakan kunjungi
ChemNet Mall
Layanan Database CAS Kimia disediakan oleh ChemIndex.com 