ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
97-95-0 2-Ethyl-1-butanol |
|
Nama produk | 2-Ethyl-1-butanol |
Nama bahasa Inggris | 2-Ethyl-1-butanol;2-Ethylbutyl alcohol;2-ethylbutan-1-ol |
MF | C6H14O |
Berat Molekul | 102.1748 |
InChI | InChI=1/C6H14O/c1-3-6(4-2)5-7/h6-7H,3-5H2,1-2H3 |
CAS NO | 97-95-0 |
EINECS | 202-621-4 |
Struktur Molekul | ![]() |
Kepadatan | 0.814g/cm3 |
Titik lebur | -15℃ |
Titik didih | 146.5°C at 760 mmHg |
Indeks bias | 1.413 |
Titik nyala | 58.3°C |
Tekanan uap | 1.81mmHg at 25°C |
Simbol bahaya | |
Kode Risiko | R21/22##Harmful in contact with skin and if swallowed.:; |
MSDS |