ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
94-32-6 ethyl 4-(butylamino)benzoate |
|
Nama produk | ethyl 4-(butylamino)benzoate |
Nama bahasa Inggris | ethyl 4-(butylamino)benzoate;Ethyl 4-(n-butylamino)benzoate;4-(n-Butylamino)benzoic acid ethyl ester;Ethyl-4-n-butylamino-benzoate |
MF | C13H19NO2 |
Berat Molekul | 221.2955 |
InChI | InChI=1/C13H19NO2/c1-3-5-10-14-12-8-6-11(7-9-12)13(15)16-4-2/h6-9,14H,3-5,10H2,1-2H3 |
CAS NO | 94-32-6 |
EINECS | 202-322-9 |
Struktur Molekul | ![]() |
Kepadatan | 1.039g/cm3 |
Titik lebur | 68-70℃ |
Titik didih | 338.4°C at 760 mmHg |
Indeks bias | 1.534 |
Titik nyala | 158.4°C |
Tekanan uap | 9.87E-05mmHg at 25°C |
Keselamatan Deskripsi | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |