ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
93-65-2 2-(4-Chloro-2-methylphenoxy)propionic acid |
|
Nama produk | 2-(4-Chloro-2-methylphenoxy)propionic acid |
Nama bahasa Inggris | 2-(4-Chloro-2-methylphenoxy)propionic acid;2-(4-Chloro-o-tolyloxy)propionic acid;MCPP;Mecoprop;(-)-2-(4-chloro-o-tolyloxy)propionic acid;(2S)-2-(4-chloro-2-methylphenoxy)propanoic acid |
MF | C10H11ClO3 |
Berat Molekul | 214.6455 |
InChI | InChI=1/C10H11ClO3/c1-6-5-8(11)3-4-9(6)14-7(2)10(12)13/h3-5,7H,1-2H3,(H,12,13)/t7-/m0/s1 |
CAS NO | 93-65-2 |
EINECS | 202-264-4;230-386-8 [1] |
Struktur Molekul | |
Kepadatan | 1.265g/cm3 |
Titik didih | 331.9°C at 760 mmHg |
Indeks bias | 1.542 |
Titik nyala | 154.5°C |
Kelarutan air | 734 mg l-1 |
Tekanan uap | 6.04E-05mmHg at 25°C |
Kode Risiko | R22##Harmful if swallowed.||R38##Irritating to skin.||R41##Risks of serious damage to eyes.:; |
Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |