ChemIndex - Basis data CAS kimia gratisChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2,3-Benzanthracene |
|
Nama produk | 2,3-Benzanthracene |
Nama bahasa Inggris | 2,3-Benzanthracene;NAPHTHACENE;Chrysogen;LT-S940;Tetracene |
MF | C18H12 |
Berat Molekul | 228.2879 |
InChI | InChI=1/C18H12/c1-2-6-14-10-18-12-16-8-4-3-7-15(16)11-17(18)9-13(14)5-1/h1-12H |
CAS NO | 92-24-0 |
EINECS | 202-138-9 |
Struktur Molekul | |
Kepadatan | 1.19g/cm3 |
Titik lebur | 300℃ |
Titik didih | 436.7°C at 760 mmHg |
Indeks bias | 1.771 |
Titik nyala | 209.1°C |
Tekanan uap | 2.02E-07mmHg at 25°C |
Simbol bahaya | Xn##Harmful:; |
Kode Risiko | R40##Possible risks of irreversible effects.:; |
Keselamatan Deskripsi | S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |