ChemIndex - Basis data CAS kimia gratisChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
6-Methyl-1,2,3,4-tetrahydroquinoline |
|
Nama produk | 6-Methyl-1,2,3,4-tetrahydroquinoline |
Nama bahasa Inggris | 6-Methyl-1,2,3,4-tetrahydroquinoline;1,2,3,4-Tetrahydro-6-methylquinoline;AI3-36188;Civettal;NSC 65606;p-Methyltetrahydroquinoline;Quinoline, 1,2,3,4-tetrahydro-6-methyl- |
MF | C10H13N |
Berat Molekul | 147.2169 |
InChI | InChI=1/C10H13N/c1-8-4-5-10-9(7-8)3-2-6-11-10/h4-5,7,11H,2-3,6H2,1H3 |
CAS NO | 91-61-2 |
EINECS | 202-083-0 |
Struktur Molekul | |
Kepadatan | 0.99g/cm3 |
Titik didih | 264.2°C at 760 mmHg |
Indeks bias | 1.539 |
Titik nyala | 119.1°C |
Tekanan uap | 0.00982mmHg at 25°C |
Kode Risiko | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Keselamatan Deskripsi | S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |